C11H12N2O3 — CID 90988641
methyl 3-(3-aminophenyl)-2,5-dihydro-1,2-oxazole-5-carboxylate (PubChem CID 90988641) has the molecular formula C11H12N2O3 and a molecular weight of 220.23 g/mol. Its IUPAC name is methyl 3-(3-aminophenyl)-2,5-dihydro-1,2-oxazole-5-carboxylate.
| Compound Name | methyl 3-(3-aminophenyl)-2,5-dihydro-1,2-oxazole-5-carboxylate |
|---|---|
| PubChem CID | 90988641 |
| Molecular Formula | C11H12N2O3 |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | methyl 3-(3-aminophenyl)-2,5-dihydro-1,2-oxazole-5-carboxylate |
| SMILES | COC(=O)C1C=C(c2cccc(N)c2)NO1 |
| InChI | InChI=1S/C11H12N2O3/c1-15-11(14)10-6-9(13-16-10)7-3-2-4-8(12)5-7/h2-6,10,13H,12H2,1H3 |
| InChIKey | MPKCUHMEOXJXLJ-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|