C10H8N2O5 — CID 57122266
3-(3-nitrophenyl)-2,5-dihydro-1,2-oxazole-5-carboxylic acid (PubChem CID 57122266) has the molecular formula C10H8N2O5 and a molecular weight of 236.18 g/mol. Its IUPAC name is 3-(3-nitrophenyl)-2,5-dihydro-1,2-oxazole-5-carboxylic acid.
| Compound Name | 3-(3-nitrophenyl)-2,5-dihydro-1,2-oxazole-5-carboxylic acid |
|---|---|
| PubChem CID | 57122266 |
| Molecular Formula | C10H8N2O5 |
| Molecular Weight | 236.18 g/mol |
| Exact Mass | 236.04 |
| IUPAC Name | 3-(3-nitrophenyl)-2,5-dihydro-1,2-oxazole-5-carboxylic acid |
| SMILES | O=C(O)C1C=C(c2cccc([N+](=O)[O-])c2)NO1 |
| InChI | InChI=1S/C10H8N2O5/c13-10(14)9-5-8(11-17-9)6-2-1-3-7(4-6)12(15)16/h1-5,9,11H,(H,13,14) |
| InChIKey | UIGXMZUOCNHJLK-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 101.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.18 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|