C10H8BNO8 — CID 71114708
2-(3-nitrophenyl)-1,3,2-dioxaborolane-4,5-dicarboxylic acid (PubChem CID 71114708) has the molecular formula C10H8BNO8 and a molecular weight of 280.99 g/mol. Its IUPAC name is 2-(3-nitrophenyl)-1,3,2-dioxaborolane-4,5-dicarboxylic acid.
| Compound Name | 2-(3-nitrophenyl)-1,3,2-dioxaborolane-4,5-dicarboxylic acid |
|---|---|
| PubChem CID | 71114708 |
| Molecular Formula | C10H8BNO8 |
| Molecular Weight | 280.99 g/mol |
| Exact Mass | 281.03 |
| IUPAC Name | 2-(3-nitrophenyl)-1,3,2-dioxaborolane-4,5-dicarboxylic acid |
| SMILES | O=C(O)C1OB(c2cccc([N+](=O)[O-])c2)OC1C(=O)O |
| InChI | InChI=1S/C10H8BNO8/c13-9(14)7-8(10(15)16)20-11(19-7)5-2-1-3-6(4-5)12(17)18/h1-4,7-8H,(H,13,14)(H,15,16) |
| InChIKey | DKYPDMHYDHHGRL-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 136.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.99 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|