C20H14ClN3O2 — CID 57117424
3-[[4-(4-chlorobenzoyl)-1-methylpyrrol-2-yl]methylidene]-1H-pyrrolo[2,3-c]pyridin-2-one (PubChem CID 57117424) has the molecular formula C20H14ClN3O2 and a molecular weight of 363.80 g/mol. Its IUPAC name is 3-[[4-(4-chlorobenzoyl)-1-methylpyrrol-2-yl]methylidene]-1H-pyrrolo[2,3-c]pyridin-2-one.
| Compound Name | 3-[[4-(4-chlorobenzoyl)-1-methylpyrrol-2-yl]methylidene]-1H-pyrrolo[2,3-c]pyridin-2-one |
|---|---|
| PubChem CID | 57117424 |
| Molecular Formula | C20H14ClN3O2 |
| Molecular Weight | 363.80 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | 3-[[4-(4-chlorobenzoyl)-1-methylpyrrol-2-yl]methylidene]-1H-pyrrolo[2,3-c]pyridin-2-one |
| SMILES | Cn1cc(C(=O)c2ccc(Cl)cc2)cc1C=C1C(=O)Nc2cnccc21 |
| InChI | InChI=1S/C20H14ClN3O2/c1-24-11-13(19(25)12-2-4-14(21)5-3-12)8-15(24)9-17-16-6-7-22-10-18(16)23-20(17)26/h2-11H,1H3,(H,23,26) |
| InChIKey | YSRDHOZUSIANQW-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.80 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|