C27H39NO5 — CID 57117890
benzyl (4S)-4-(cyclohexylmethyl)-5-(2-ethoxycarbonylbut-1-enyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 57117890) has the molecular formula C27H39NO5 and a molecular weight of 457.61 g/mol. Its IUPAC name is benzyl (4S)-4-(cyclohexylmethyl)-5-(2-ethoxycarbonylbut-1-enyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | benzyl (4S)-4-(cyclohexylmethyl)-5-(2-ethoxycarbonylbut-1-enyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 57117890 |
| Molecular Formula | C27H39NO5 |
| Molecular Weight | 457.61 g/mol |
| Exact Mass | 457.28 |
| IUPAC Name | benzyl (4S)-4-(cyclohexylmethyl)-5-(2-ethoxycarbonylbut-1-enyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | CCOC(=O)C(=CC1OC(C)(C)N(C(=O)OCc2ccccc2)[C@H]1CC1CCCCC1)CC |
| InChI | InChI=1S/C27H39NO5/c1-5-22(25(29)31-6-2)18-24-23(17-20-13-9-7-10-14-20)28(27(3,4)33-24)26(30)32-19-21-15-11-8-12-16-21/h8,11-12,15-16,18,20,23-24H,5-7,9-10,13-14,17,19H2,1-4H3/t23-,24?/m0/s1 |
| InChIKey | WNZQTLUJUBBBDH-UXMRNZNESA-N |
| XLogP | 6.00 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.61 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|