C20H35NO6 — CID 57119073
5-amino-2-(cyclohexylmethyl)-2-ethoxycarbonyl-6-[(2-methylpropan-2-yl)oxy]-6-oxohexanoic acid (PubChem CID 57119073) has the molecular formula C20H35NO6 and a molecular weight of 385.50 g/mol. Its IUPAC name is 5-amino-2-(cyclohexylmethyl)-2-ethoxycarbonyl-6-[(2-methylpropan-2-yl)oxy]-6-oxohexanoic acid.
| Compound Name | 5-amino-2-(cyclohexylmethyl)-2-ethoxycarbonyl-6-[(2-methylpropan-2-yl)oxy]-6-oxohexanoic acid |
|---|---|
| PubChem CID | 57119073 |
| Molecular Formula | C20H35NO6 |
| Molecular Weight | 385.50 g/mol |
| Exact Mass | 385.25 |
| IUPAC Name | 5-amino-2-(cyclohexylmethyl)-2-ethoxycarbonyl-6-[(2-methylpropan-2-yl)oxy]-6-oxohexanoic acid |
| SMILES | CCOC(=O)C(CCC(N)C(=O)OC(C)(C)C)(CC1CCCCC1)C(=O)O |
| InChI | InChI=1S/C20H35NO6/c1-5-26-18(25)20(17(23)24,13-14-9-7-6-8-10-14)12-11-15(21)16(22)27-19(2,3)4/h14-15H,5-13,21H2,1-4H3,(H,23,24) |
| InChIKey | IKEVZJBLXQDVDM-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 115.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.50 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|