C26H43NO6 — CID 67694815
1-O-tert-butyl 4-O,4-O-bis(prop-2-enyl) 1-amino-7-cyclohexylheptane-1,4,4-tricarboxylate (PubChem CID 67694815) has the molecular formula C26H43NO6 and a molecular weight of 465.63 g/mol. Its IUPAC name is 1-O-tert-butyl 4-O,4-O-bis(prop-2-enyl) 1-amino-7-cyclohexylheptane-1,4,4-tricarboxylate.
| Compound Name | 1-O-tert-butyl 4-O,4-O-bis(prop-2-enyl) 1-amino-7-cyclohexylheptane-1,4,4-tricarboxylate |
|---|---|
| PubChem CID | 67694815 |
| Molecular Formula | C26H43NO6 |
| Molecular Weight | 465.63 g/mol |
| Exact Mass | 465.31 |
| IUPAC Name | 1-O-tert-butyl 4-O,4-O-bis(prop-2-enyl) 1-amino-7-cyclohexylheptane-1,4,4-tricarboxylate |
| SMILES | C=CCOC(=O)C(CCCC1CCCCC1)(CCC(N)C(=O)OC(C)(C)C)C(=O)OCC=C |
| InChI | InChI=1S/C26H43NO6/c1-6-18-31-23(29)26(24(30)32-19-7-2,16-11-14-20-12-9-8-10-13-20)17-15-21(27)22(28)33-25(3,4)5/h6-7,20-21H,1-2,8-19,27H2,3-5H3 |
| InChIKey | CEWNVTJDHMFFRI-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 104.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.63 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|