C19H34O3 — CID 69494303
tert-butyl 2-ethyl-4-[(1S,3S)-3-prop-2-enoxycyclohexyl]butanoate (PubChem CID 69494303) has the molecular formula C19H34O3 and a molecular weight of 310.48 g/mol. Its IUPAC name is tert-butyl 2-ethyl-4-[(1S,3S)-3-prop-2-enoxycyclohexyl]butanoate.
| Compound Name | tert-butyl 2-ethyl-4-[(1S,3S)-3-prop-2-enoxycyclohexyl]butanoate |
|---|---|
| PubChem CID | 69494303 |
| Molecular Formula | C19H34O3 |
| Molecular Weight | 310.48 g/mol |
| Exact Mass | 310.25 |
| IUPAC Name | tert-butyl 2-ethyl-4-[(1S,3S)-3-prop-2-enoxycyclohexyl]butanoate |
| SMILES | C=CCO[C@H]1CCC[C@@H](CCC(CC)C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C19H34O3/c1-6-13-21-17-10-8-9-15(14-17)11-12-16(7-2)18(20)22-19(3,4)5/h6,15-17H,1,7-14H2,2-5H3/t15-,16?,17-/m0/s1 |
| InChIKey | YKJSPULFYRDUFL-QRFGZVGRSA-N |
| XLogP | 4.90 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.48 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|