C27H30N6O8 — CID 57120247
(4S,12aS)-4-(dimethylamino)-10,12a-dihydroxy-9-[[2-(1H-imidazol-2-ylmethylamino)acetyl]amino]-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 57120247) has the molecular formula C27H30N6O8 and a molecular weight of 566.57 g/mol. Its IUPAC name is (4S,12aS)-4-(dimethylamino)-10,12a-dihydroxy-9-[[2-(1H-imidazol-2-ylmethylamino)acetyl]amino]-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4S,12aS)-4-(dimethylamino)-10,12a-dihydroxy-9-[[2-(1H-imidazol-2-ylmethylamino)acetyl]amino]-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 57120247 |
| Molecular Formula | C27H30N6O8 |
| Molecular Weight | 566.57 g/mol |
| Exact Mass | 566.21 |
| IUPAC Name | (4S,12aS)-4-(dimethylamino)-10,12a-dihydroxy-9-[[2-(1H-imidazol-2-ylmethylamino)acetyl]amino]-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CN(C)[C@@H]1C(=O)C(C(N)=O)C(=O)[C@@]2(O)C(=O)C3C(=O)c4c(ccc(NC(=O)CNCc5ncc[nH]5)c4O)CC3CC12 |
| InChI | InChI=1S/C27H30N6O8/c1-33(2)20-13-8-12-7-11-3-4-14(32-16(34)10-29-9-15-30-5-6-31-15)21(35)17(11)22(36)18(12)24(38)27(13,41)25(39)19(23(20)37)26(28)40/h3-6,12-13,18-20,29,35,41H,7-10H2,1-2H3,(H2,28,40)(H,30,31)(H,32,34)/t12?,13?,18?,19?,20-,27-/m0/s1 |
| InChIKey | OCSCPQQKSATKCQ-KTSUQZPQSA-N |
| XLogP | -1.68 |
| TPSA | 224.88 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.57 |
| LogP ≤ 5 | -1.68 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|