C25H24FN5O7 — CID 91207478
(4S,4aS,5aR,12aS)-4-(dimethylamino)-7-fluoro-10,12a-dihydroxy-1,3,11,12-tetraoxo-9-(pyrimidin-4-ylamino)-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 91207478) has the molecular formula C25H24FN5O7 and a molecular weight of 525.49 g/mol. Its IUPAC name is (4S,4aS,5aR,12aS)-4-(dimethylamino)-7-fluoro-10,12a-dihydroxy-1,3,11,12-tetraoxo-9-(pyrimidin-4-ylamino)-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,12aS)-4-(dimethylamino)-7-fluoro-10,12a-dihydroxy-1,3,11,12-tetraoxo-9-(pyrimidin-4-ylamino)-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 91207478 |
| Molecular Formula | C25H24FN5O7 |
| Molecular Weight | 525.49 g/mol |
| Exact Mass | 525.17 |
| IUPAC Name | (4S,4aS,5aR,12aS)-4-(dimethylamino)-7-fluoro-10,12a-dihydroxy-1,3,11,12-tetraoxo-9-(pyrimidin-4-ylamino)-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CN(C)[C@@H]1C(=O)C(C(N)=O)C(=O)[C@@]2(O)C(=O)C3C(=O)c4c(O)c(Nc5ccncn5)cc(F)c4C[C@H]3C[C@@H]12 |
| InChI | InChI=1S/C25H24FN5O7/c1-31(2)18-11-6-9-5-10-12(26)7-13(30-14-3-4-28-8-29-14)19(32)16(10)20(33)15(9)22(35)25(11,38)23(36)17(21(18)34)24(27)37/h3-4,7-9,11,15,17-18,32,38H,5-6H2,1-2H3,(H2,27,37)(H,28,29,30)/t9-,11-,15?,17?,18-,25-/m0/s1 |
| InChIKey | JAXKZFNZVQQCES-OTLICBHKSA-N |
| XLogP | -0.46 |
| TPSA | 192.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.49 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|