C18H26OSSi — CID 57123733
4-[2-[dimethyl(thiophen-2-yl)silyl]ethyl]-2,6-diethylphenol (PubChem CID 57123733) has the molecular formula C18H26OSSi and a molecular weight of 318.56 g/mol. Its IUPAC name is 4-[2-[dimethyl(thiophen-2-yl)silyl]ethyl]-2,6-diethylphenol.
| Compound Name | 4-[2-[dimethyl(thiophen-2-yl)silyl]ethyl]-2,6-diethylphenol |
|---|---|
| PubChem CID | 57123733 |
| Molecular Formula | C18H26OSSi |
| Molecular Weight | 318.56 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | 4-[2-[dimethyl(thiophen-2-yl)silyl]ethyl]-2,6-diethylphenol |
| SMILES | CCc1cc(CC[Si](C)(C)c2cccs2)cc(CC)c1O |
| InChI | InChI=1S/C18H26OSSi/c1-5-15-12-14(13-16(6-2)18(15)19)9-11-21(3,4)17-8-7-10-20-17/h7-8,10,12-13,19H,5-6,9,11H2,1-4H3 |
| InChIKey | OLUHPRPHMDTEKH-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.56 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|