C21H20FIN2O — CID 57124281
N-(4-fluorobutan-2-yl)-1-[(4-iodophenyl)methyl]isoquinoline-3-carboxamide (PubChem CID 57124281) has the molecular formula C21H20FIN2O and a molecular weight of 462.31 g/mol. Its IUPAC name is N-(4-fluorobutan-2-yl)-1-[(4-iodophenyl)methyl]isoquinoline-3-carboxamide.
| Compound Name | N-(4-fluorobutan-2-yl)-1-[(4-iodophenyl)methyl]isoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 57124281 |
| Molecular Formula | C21H20FIN2O |
| Molecular Weight | 462.31 g/mol |
| Exact Mass | 462.06 |
| IUPAC Name | N-(4-fluorobutan-2-yl)-1-[(4-iodophenyl)methyl]isoquinoline-3-carboxamide |
| SMILES | CC(CCF)NC(=O)c1cc2ccccc2c(Cc2ccc(I)cc2)n1 |
| InChI | InChI=1S/C21H20FIN2O/c1-14(10-11-22)24-21(26)20-13-16-4-2-3-5-18(16)19(25-20)12-15-6-8-17(23)9-7-15/h2-9,13-14H,10-12H2,1H3,(H,24,26) |
| InChIKey | WDBUVQFPTKQSBG-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.31 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|