C25H30N2O4 — CID 57124700
2-[[6-[[(2-cyclopentyl-1-pyridin-3-ylethenyl)amino]oxymethyl]-5,6,7,8-tetrahydronaphthalen-1-yl]oxy]acetic acid (PubChem CID 57124700) has the molecular formula C25H30N2O4 and a molecular weight of 422.53 g/mol. Its IUPAC name is 2-[[6-[[(2-cyclopentyl-1-pyridin-3-ylethenyl)amino]oxymethyl]-5,6,7,8-tetrahydronaphthalen-1-yl]oxy]acetic acid.
| Compound Name | 2-[[6-[[(2-cyclopentyl-1-pyridin-3-ylethenyl)amino]oxymethyl]-5,6,7,8-tetrahydronaphthalen-1-yl]oxy]acetic acid |
|---|---|
| PubChem CID | 57124700 |
| Molecular Formula | C25H30N2O4 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | 2-[[6-[[(2-cyclopentyl-1-pyridin-3-ylethenyl)amino]oxymethyl]-5,6,7,8-tetrahydronaphthalen-1-yl]oxy]acetic acid |
| SMILES | O=C(O)COc1cccc2c1CCC(CONC(=CC1CCCC1)c1cccnc1)C2 |
| InChI | InChI=1S/C25H30N2O4/c28-25(29)17-30-24-9-3-7-20-13-19(10-11-22(20)24)16-31-27-23(14-18-5-1-2-6-18)21-8-4-12-26-15-21/h3-4,7-9,12,14-15,18-19,27H,1-2,5-6,10-11,13,16-17H2,(H,28,29) |
| InChIKey | RAOGZRBDJKZEMJ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|