C21H14BrN3OS — CID 571270
N-[4-(4-bromophenyl)-3-phenyl-1,2,4-thiadiazol-5-ylidene]benzamide (PubChem CID 571270) has the molecular formula C21H14BrN3OS and a molecular weight of 436.33 g/mol. Its IUPAC name is N-[4-(4-bromophenyl)-3-phenyl-1,2,4-thiadiazol-5-ylidene]benzamide.
| Compound Name | N-[4-(4-bromophenyl)-3-phenyl-1,2,4-thiadiazol-5-ylidene]benzamide |
|---|---|
| PubChem CID | 571270 |
| Molecular Formula | C21H14BrN3OS |
| Molecular Weight | 436.33 g/mol |
| Exact Mass | 435.00 |
| IUPAC Name | N-[4-(4-bromophenyl)-3-phenyl-1,2,4-thiadiazol-5-ylidene]benzamide |
| SMILES | O=C(/N=c1\snc(-c2ccccc2)n1-c1ccc(Br)cc1)c1ccccc1 |
| InChI | InChI=1S/C21H14BrN3OS/c22-17-11-13-18(14-12-17)25-19(15-7-3-1-4-8-15)24-27-21(25)23-20(26)16-9-5-2-6-10-16/h1-14H/b23-21- |
| InChIKey | NIDKEMKZRUPSTD-LNVKXUELSA-N |
| XLogP | 5.10 |
| TPSA | 47.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.33 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_thio_N_5A(3)', 'substructure': 'N/A'} |
|---|