C18H22ClN3 — CID 57132345
1-[4-(2-chloroethyl)phenyl]-2-[(3-ethylphenyl)methyl]guanidine (PubChem CID 57132345) has the molecular formula C18H22ClN3 and a molecular weight of 315.85 g/mol. Its IUPAC name is 1-[4-(2-chloroethyl)phenyl]-2-[(3-ethylphenyl)methyl]guanidine.
| Compound Name | 1-[4-(2-chloroethyl)phenyl]-2-[(3-ethylphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 57132345 |
| Molecular Formula | C18H22ClN3 |
| Molecular Weight | 315.85 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | 1-[4-(2-chloroethyl)phenyl]-2-[(3-ethylphenyl)methyl]guanidine |
| SMILES | CCc1cccc(C/N=C(\N)Nc2ccc(CCCl)cc2)c1 |
| InChI | InChI=1S/C18H22ClN3/c1-2-14-4-3-5-16(12-14)13-21-18(20)22-17-8-6-15(7-9-17)10-11-19/h3-9,12H,2,10-11,13H2,1H3,(H3,20,21,22) |
| InChIKey | JUXZJJLZZNBAQE-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.85 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|