C16H32O2 — CID 57132436
6-ethenyltetradecane-6,7-diol (PubChem CID 57132436) has the molecular formula C16H32O2 and a molecular weight of 256.43 g/mol. Its IUPAC name is 6-ethenyltetradecane-6,7-diol.
| Compound Name | 6-ethenyltetradecane-6,7-diol |
|---|---|
| PubChem CID | 57132436 |
| Molecular Formula | C16H32O2 |
| Molecular Weight | 256.43 g/mol |
| Exact Mass | 256.24 |
| IUPAC Name | 6-ethenyltetradecane-6,7-diol |
| SMILES | C=CC(O)(CCCCC)C(O)CCCCCCC |
| InChI | InChI=1S/C16H32O2/c1-4-7-9-10-11-13-15(17)16(18,6-3)14-12-8-5-2/h6,15,17-18H,3-5,7-14H2,1-2H3 |
| InChIKey | VUDZQEIAGPDOEQ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.43 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|