C26H34BrNO5 — CID 57134001
diethyl 2-[1-(4-bromophenyl)pentyl]-6-butoxypyridine-3,5-dicarboxylate (PubChem CID 57134001) has the molecular formula C26H34BrNO5 and a molecular weight of 520.46 g/mol. Its IUPAC name is diethyl 2-[1-(4-bromophenyl)pentyl]-6-butoxypyridine-3,5-dicarboxylate.
| Compound Name | diethyl 2-[1-(4-bromophenyl)pentyl]-6-butoxypyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 57134001 |
| Molecular Formula | C26H34BrNO5 |
| Molecular Weight | 520.46 g/mol |
| Exact Mass | 519.16 |
| IUPAC Name | diethyl 2-[1-(4-bromophenyl)pentyl]-6-butoxypyridine-3,5-dicarboxylate |
| SMILES | CCCCOc1nc(C(CCCC)c2ccc(Br)cc2)c(C(=O)OCC)cc1C(=O)OCC |
| InChI | InChI=1S/C26H34BrNO5/c1-5-9-11-20(18-12-14-19(27)15-13-18)23-21(25(29)31-7-3)17-22(26(30)32-8-4)24(28-23)33-16-10-6-2/h12-15,17,20H,5-11,16H2,1-4H3 |
| InChIKey | MIAMFGJTNAJVMD-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 74.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.46 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|