C24H35BrO4Si — CID 11225682
diethyl 2-[(1S,2R)-1-(4-bromophenyl)-2-(2-trimethylsilylethynyl)hexyl]propanedioate (PubChem CID 11225682) has the molecular formula C24H35BrO4Si and a molecular weight of 495.53 g/mol. Its IUPAC name is diethyl 2-[(1S,2R)-1-(4-bromophenyl)-2-(2-trimethylsilylethynyl)hexyl]propanedioate.
| Compound Name | diethyl 2-[(1S,2R)-1-(4-bromophenyl)-2-(2-trimethylsilylethynyl)hexyl]propanedioate |
|---|---|
| PubChem CID | 11225682 |
| Molecular Formula | C24H35BrO4Si |
| Molecular Weight | 495.53 g/mol |
| Exact Mass | 494.15 |
| IUPAC Name | diethyl 2-[(1S,2R)-1-(4-bromophenyl)-2-(2-trimethylsilylethynyl)hexyl]propanedioate |
| SMILES | CCCC[C@@H](C#C[Si](C)(C)C)[C@H](c1ccc(Br)cc1)C(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C24H35BrO4Si/c1-7-10-11-18(16-17-30(4,5)6)21(19-12-14-20(25)15-13-19)22(23(26)28-8-2)24(27)29-9-3/h12-15,18,21-22H,7-11H2,1-6H3/t18-,21+/m0/s1 |
| InChIKey | FCJJTWSXAICEJZ-GHTZIAJQSA-N |
| XLogP | 5.96 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.53 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|