C19H22N2O4 — CID 57135639
(2S,3R)-3-hydroxy-2-[(2-phenylacetyl)-phenylmethoxyamino]butanamide (PubChem CID 57135639) has the molecular formula C19H22N2O4 and a molecular weight of 342.39 g/mol. Its IUPAC name is (2S,3R)-3-hydroxy-2-[(2-phenylacetyl)-phenylmethoxyamino]butanamide.
| Compound Name | (2S,3R)-3-hydroxy-2-[(2-phenylacetyl)-phenylmethoxyamino]butanamide |
|---|---|
| PubChem CID | 57135639 |
| Molecular Formula | C19H22N2O4 |
| Molecular Weight | 342.39 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | (2S,3R)-3-hydroxy-2-[(2-phenylacetyl)-phenylmethoxyamino]butanamide |
| SMILES | C[C@@H](O)[C@@H](C(N)=O)N(OCc1ccccc1)C(=O)Cc1ccccc1 |
| InChI | InChI=1S/C19H22N2O4/c1-14(22)18(19(20)24)21(25-13-16-10-6-3-7-11-16)17(23)12-15-8-4-2-5-9-15/h2-11,14,18,22H,12-13H2,1H3,(H2,20,24)/t14-,18+/m1/s1 |
| InChIKey | HVXVAHQOCMPXME-KDOFPFPSSA-N |
| XLogP | 1.42 |
| TPSA | 92.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.39 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|