C16H24N2O6 — CID 57290787
benzyl N-[(2S,3R)-1-amino-3-hydroxy-1-oxobutan-2-yl]-N-(2-methoxypropan-2-yloxy)carbamate (PubChem CID 57290787) has the molecular formula C16H24N2O6 and a molecular weight of 340.38 g/mol. Its IUPAC name is benzyl N-[(2S,3R)-1-amino-3-hydroxy-1-oxobutan-2-yl]-N-(2-methoxypropan-2-yloxy)carbamate.
| Compound Name | benzyl N-[(2S,3R)-1-amino-3-hydroxy-1-oxobutan-2-yl]-N-(2-methoxypropan-2-yloxy)carbamate |
|---|---|
| PubChem CID | 57290787 |
| Molecular Formula | C16H24N2O6 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | benzyl N-[(2S,3R)-1-amino-3-hydroxy-1-oxobutan-2-yl]-N-(2-methoxypropan-2-yloxy)carbamate |
| SMILES | COC(C)(C)ON(C(=O)OCc1ccccc1)[C@H](C(N)=O)[C@@H](C)O |
| InChI | InChI=1S/C16H24N2O6/c1-11(19)13(14(17)20)18(24-16(2,3)22-4)15(21)23-10-12-8-6-5-7-9-12/h5-9,11,13,19H,10H2,1-4H3,(H2,17,20)/t11-,13+/m1/s1 |
| InChIKey | BCSSEEFWXWZDKN-YPMHNXCESA-N |
| XLogP | 1.17 |
| TPSA | 111.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|