C5H5N5S — CID 57135663
3-(1H-1,2,4-triazol-5-ylmethyl)-1,2,4-thiadiazole (PubChem CID 57135663) has the molecular formula C5H5N5S and a molecular weight of 167.20 g/mol. Its IUPAC name is 3-(1H-1,2,4-triazol-5-ylmethyl)-1,2,4-thiadiazole.
| Compound Name | 3-(1H-1,2,4-triazol-5-ylmethyl)-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 57135663 |
| Molecular Formula | C5H5N5S |
| Molecular Weight | 167.20 g/mol |
| Exact Mass | 167.03 |
| IUPAC Name | 3-(1H-1,2,4-triazol-5-ylmethyl)-1,2,4-thiadiazole |
| SMILES | c1n[nH]c(Cc2ncsn2)n1 |
| InChI | InChI=1S/C5H5N5S/c1(4-6-2-8-9-4)5-7-3-11-10-5/h2-3H,1H2,(H,6,8,9) |
| InChIKey | HESJIDWEZKBGFP-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.20 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |