C37H32B2F4N4 — CID 57137516
CID 57137516 (PubChem CID 57137516) has the molecular formula C37H32B2F4N4 and a molecular weight of 630.31 g/mol.
| Compound Name | CID 57137516 |
|---|---|
| PubChem CID | 57137516 |
| Molecular Formula | C37H32B2F4N4 |
| Molecular Weight | 630.31 g/mol |
| Exact Mass | 630.27 |
| IUPAC Name | — |
| SMILES | Fc1cccc(C(c2cccc(F)c2)C([B]CCC[B]C(c2ncc[nH]2)C(c2cccc(F)c2)c2cccc(F)c2)c2ncc[nH]2)c1 |
| InChI | InChI=1S/C37H32B2F4N4/c40-28-10-1-6-24(20-28)32(25-7-2-11-29(41)21-25)34(36-44-16-17-45-36)38-14-5-15-39-35(37-46-18-19-47-37)33(26-8-3-12-30(42)22-26)27-9-4-13-31(43)23-27/h1-4,6-13,16-23,32-35H,5,14-15H2,(H,44,45)(H,46,47) |
| InChIKey | VOPRCNBAOKBYRU-UHFFFAOYSA-N |
| XLogP | 8.77 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.31 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|