C19H26Si2 — CID 57140253
(2-cyclopenta-1,3-dien-1-yl-5-trimethylsilylpentalen-1-yl)-trimethylsilane (PubChem CID 57140253) has the molecular formula C19H26Si2 and a molecular weight of 310.59 g/mol. Its IUPAC name is (2-cyclopenta-1,3-dien-1-yl-5-trimethylsilylpentalen-1-yl)-trimethylsilane.
| Compound Name | (2-cyclopenta-1,3-dien-1-yl-5-trimethylsilylpentalen-1-yl)-trimethylsilane |
|---|---|
| PubChem CID | 57140253 |
| Molecular Formula | C19H26Si2 |
| Molecular Weight | 310.59 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | (2-cyclopenta-1,3-dien-1-yl-5-trimethylsilylpentalen-1-yl)-trimethylsilane |
| SMILES | C[Si](C)(C)C1=CC2=CC(C3=CC=CC3)=C([Si](C)(C)C)C2=C1 |
| InChI | InChI=1S/C19H26Si2/c1-20(2,3)16-11-15-12-17(14-9-7-8-10-14)19(18(15)13-16)21(4,5)6/h7-9,11-13H,10H2,1-6H3 |
| InChIKey | GTMGOVBPMRMUIX-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.59 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|