C14H24Si — CID 11172063
dimethyl-prop-2-enyl-(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)silane (PubChem CID 11172063) has the molecular formula C14H24Si and a molecular weight of 220.43 g/mol. Its IUPAC name is dimethyl-prop-2-enyl-(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)silane.
| Compound Name | dimethyl-prop-2-enyl-(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)silane |
|---|---|
| PubChem CID | 11172063 |
| Molecular Formula | C14H24Si |
| Molecular Weight | 220.43 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | dimethyl-prop-2-enyl-(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)silane |
| SMILES | C=CC[Si](C)(C)C1C(C)=C(C)C(C)=C1C |
| InChI | InChI=1S/C14H24Si/c1-8-9-15(6,7)14-12(4)10(2)11(3)13(14)5/h8,14H,1,9H2,2-7H3 |
| InChIKey | OTSIZBNOJLGLTJ-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.43 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|