C7H18N4O4 — CID 57140941
2,2-dihydroxyethyl N-[2-(2-aminoethylamino)ethylamino]carbamate (PubChem CID 57140941) has the molecular formula C7H18N4O4 and a molecular weight of 222.24 g/mol. Its IUPAC name is 2,2-dihydroxyethyl N-[2-(2-aminoethylamino)ethylamino]carbamate.
| Compound Name | 2,2-dihydroxyethyl N-[2-(2-aminoethylamino)ethylamino]carbamate |
|---|---|
| PubChem CID | 57140941 |
| Molecular Formula | C7H18N4O4 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | 2,2-dihydroxyethyl N-[2-(2-aminoethylamino)ethylamino]carbamate |
| SMILES | NCCNCCNNC(=O)OCC(O)O |
| InChI | InChI=1S/C7H18N4O4/c8-1-2-9-3-4-10-11-7(14)15-5-6(12)13/h6,9-10,12-13H,1-5,8H2,(H,11,14) |
| InChIKey | LRUFPJRKYZLYKR-UHFFFAOYSA-N |
| XLogP | -2.92 |
| TPSA | 128.87 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | -2.92 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|