C32H34N2O4 — CID 57141386
3-methyl-5-[1-[1-oxo-1-(2-phenylethylamino)propan-2-yl]-5-phenylmethoxyindol-3-yl]pent-2-enoic acid (PubChem CID 57141386) has the molecular formula C32H34N2O4 and a molecular weight of 510.63 g/mol. Its IUPAC name is 3-methyl-5-[1-[1-oxo-1-(2-phenylethylamino)propan-2-yl]-5-phenylmethoxyindol-3-yl]pent-2-enoic acid.
| Compound Name | 3-methyl-5-[1-[1-oxo-1-(2-phenylethylamino)propan-2-yl]-5-phenylmethoxyindol-3-yl]pent-2-enoic acid |
|---|---|
| PubChem CID | 57141386 |
| Molecular Formula | C32H34N2O4 |
| Molecular Weight | 510.63 g/mol |
| Exact Mass | 510.25 |
| IUPAC Name | 3-methyl-5-[1-[1-oxo-1-(2-phenylethylamino)propan-2-yl]-5-phenylmethoxyindol-3-yl]pent-2-enoic acid |
| SMILES | CC(=CC(=O)O)CCc1cn(C(C)C(=O)NCCc2ccccc2)c2ccc(OCc3ccccc3)cc12 |
| InChI | InChI=1S/C32H34N2O4/c1-23(19-31(35)36)13-14-27-21-34(24(2)32(37)33-18-17-25-9-5-3-6-10-25)30-16-15-28(20-29(27)30)38-22-26-11-7-4-8-12-26/h3-12,15-16,19-21,24H,13-14,17-18,22H2,1-2H3,(H,33,37)(H,35,36) |
| InChIKey | PQTSYYQNLLQCTJ-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 80.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.63 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|