C29H30N2O4 — CID 57037980
3-[1-[1-oxo-1-(2-phenylethylamino)propan-2-yl]-6-phenylmethoxyindol-3-yl]propanoic acid (PubChem CID 57037980) has the molecular formula C29H30N2O4 and a molecular weight of 470.57 g/mol. Its IUPAC name is 3-[1-[1-oxo-1-(2-phenylethylamino)propan-2-yl]-6-phenylmethoxyindol-3-yl]propanoic acid.
| Compound Name | 3-[1-[1-oxo-1-(2-phenylethylamino)propan-2-yl]-6-phenylmethoxyindol-3-yl]propanoic acid |
|---|---|
| PubChem CID | 57037980 |
| Molecular Formula | C29H30N2O4 |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.22 |
| IUPAC Name | 3-[1-[1-oxo-1-(2-phenylethylamino)propan-2-yl]-6-phenylmethoxyindol-3-yl]propanoic acid |
| SMILES | CC(C(=O)NCCc1ccccc1)n1cc(CCC(=O)O)c2ccc(OCc3ccccc3)cc21 |
| InChI | InChI=1S/C29H30N2O4/c1-21(29(34)30-17-16-22-8-4-2-5-9-22)31-19-24(12-15-28(32)33)26-14-13-25(18-27(26)31)35-20-23-10-6-3-7-11-23/h2-11,13-14,18-19,21H,12,15-17,20H2,1H3,(H,30,34)(H,32,33) |
| InChIKey | LVWOBSPLSRWKHW-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 80.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |