C19H10N4O6S — CID 57142335
2-[4-carboxy-6-(4-carboxy-2-pyridinyl)-2-pyridinyl]-3-thiocyanatopyridine-4-carboxylic acid (PubChem CID 57142335) has the molecular formula C19H10N4O6S and a molecular weight of 422.38 g/mol. Its IUPAC name is 2-[4-carboxy-6-(4-carboxy-2-pyridinyl)-2-pyridinyl]-3-thiocyanatopyridine-4-carboxylic acid.
| Compound Name | 2-[4-carboxy-6-(4-carboxy-2-pyridinyl)-2-pyridinyl]-3-thiocyanatopyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 57142335 |
| Molecular Formula | C19H10N4O6S |
| Molecular Weight | 422.38 g/mol |
| Exact Mass | 422.03 |
| IUPAC Name | 2-[4-carboxy-6-(4-carboxy-2-pyridinyl)-2-pyridinyl]-3-thiocyanatopyridine-4-carboxylic acid |
| SMILES | N#CSc1c(C(=O)O)ccnc1-c1cc(C(=O)O)cc(-c2cc(C(=O)O)ccn2)n1 |
| InChI | InChI=1S/C19H10N4O6S/c20-8-30-16-11(19(28)29)2-4-22-15(16)14-7-10(18(26)27)6-13(23-14)12-5-9(17(24)25)1-3-21-12/h1-7H,(H,24,25)(H,26,27)(H,28,29) |
| InChIKey | NKILKEFKMSAXJU-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 174.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.38 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|