C14H13F6N3OS — CID 57142421
2-[3-[3,5-bis(trifluoromethyl)phenyl]-2,5-dihydro-1,2-oxazol-5-yl]ethylthiourea (PubChem CID 57142421) has the molecular formula C14H13F6N3OS and a molecular weight of 385.33 g/mol. Its IUPAC name is 2-[3-[3,5-bis(trifluoromethyl)phenyl]-2,5-dihydro-1,2-oxazol-5-yl]ethylthiourea.
| Compound Name | 2-[3-[3,5-bis(trifluoromethyl)phenyl]-2,5-dihydro-1,2-oxazol-5-yl]ethylthiourea |
|---|---|
| PubChem CID | 57142421 |
| Molecular Formula | C14H13F6N3OS |
| Molecular Weight | 385.33 g/mol |
| Exact Mass | 385.07 |
| IUPAC Name | 2-[3-[3,5-bis(trifluoromethyl)phenyl]-2,5-dihydro-1,2-oxazol-5-yl]ethylthiourea |
| SMILES | NC(=S)NCCC1C=C(c2cc(C(F)(F)F)cc(C(F)(F)F)c2)NO1 |
| InChI | InChI=1S/C14H13F6N3OS/c15-13(16,17)8-3-7(4-9(5-8)14(18,19)20)11-6-10(24-23-11)1-2-22-12(21)25/h3-6,10,23H,1-2H2,(H3,21,22,25) |
| InChIKey | TZKKURJLBKPGNG-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.33 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|