C17H25N3OS — CID 57306115
1-[2-[3-(2,5-diethylphenyl)-2,5-dihydro-1,2-oxazol-5-yl]ethyl]-3-methylthiourea (PubChem CID 57306115) has the molecular formula C17H25N3OS and a molecular weight of 319.47 g/mol. Its IUPAC name is 1-[2-[3-(2,5-diethylphenyl)-2,5-dihydro-1,2-oxazol-5-yl]ethyl]-3-methylthiourea.
| Compound Name | 1-[2-[3-(2,5-diethylphenyl)-2,5-dihydro-1,2-oxazol-5-yl]ethyl]-3-methylthiourea |
|---|---|
| PubChem CID | 57306115 |
| Molecular Formula | C17H25N3OS |
| Molecular Weight | 319.47 g/mol |
| Exact Mass | 319.17 |
| IUPAC Name | 1-[2-[3-(2,5-diethylphenyl)-2,5-dihydro-1,2-oxazol-5-yl]ethyl]-3-methylthiourea |
| SMILES | CCc1ccc(CC)c(C2=CC(CCNC(=S)NC)ON2)c1 |
| InChI | InChI=1S/C17H25N3OS/c1-4-12-6-7-13(5-2)15(10-12)16-11-14(21-20-16)8-9-19-17(22)18-3/h6-7,10-11,14,20H,4-5,8-9H2,1-3H3,(H2,18,19,22) |
| InChIKey | SBVNWHNWUADADF-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 45.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.47 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|