C23H35N3OS — CID 57051657
N-[2-[3-[2,4-di(propan-2-yl)phenyl]-2,5-dihydro-1,2-oxazol-5-yl]ethyl]piperidine-1-carbothioamide (PubChem CID 57051657) has the molecular formula C23H35N3OS and a molecular weight of 401.62 g/mol. Its IUPAC name is N-[2-[3-[2,4-di(propan-2-yl)phenyl]-2,5-dihydro-1,2-oxazol-5-yl]ethyl]piperidine-1-carbothioamide.
| Compound Name | N-[2-[3-[2,4-di(propan-2-yl)phenyl]-2,5-dihydro-1,2-oxazol-5-yl]ethyl]piperidine-1-carbothioamide |
|---|---|
| PubChem CID | 57051657 |
| Molecular Formula | C23H35N3OS |
| Molecular Weight | 401.62 g/mol |
| Exact Mass | 401.25 |
| IUPAC Name | N-[2-[3-[2,4-di(propan-2-yl)phenyl]-2,5-dihydro-1,2-oxazol-5-yl]ethyl]piperidine-1-carbothioamide |
| SMILES | CC(C)c1ccc(C2=CC(CCNC(=S)N3CCCCC3)ON2)c(C(C)C)c1 |
| InChI | InChI=1S/C23H35N3OS/c1-16(2)18-8-9-20(21(14-18)17(3)4)22-15-19(27-25-22)10-11-24-23(28)26-12-6-5-7-13-26/h8-9,14-17,19,25H,5-7,10-13H2,1-4H3,(H,24,28) |
| InChIKey | BHVMUKOAJMXGDL-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.62 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|