C23H33N3OS — CID 91099719
N-cyclooctyl-3-(4-methylphenyl)-1-oxa-2,8-diazaspiro[4.5]dec-3-ene-8-carbothioamide (PubChem CID 91099719) has the molecular formula C23H33N3OS and a molecular weight of 399.60 g/mol. Its IUPAC name is N-cyclooctyl-3-(4-methylphenyl)-1-oxa-2,8-diazaspiro[4.5]dec-3-ene-8-carbothioamide.
| Compound Name | N-cyclooctyl-3-(4-methylphenyl)-1-oxa-2,8-diazaspiro[4.5]dec-3-ene-8-carbothioamide |
|---|---|
| PubChem CID | 91099719 |
| Molecular Formula | C23H33N3OS |
| Molecular Weight | 399.60 g/mol |
| Exact Mass | 399.23 |
| IUPAC Name | N-cyclooctyl-3-(4-methylphenyl)-1-oxa-2,8-diazaspiro[4.5]dec-3-ene-8-carbothioamide |
| SMILES | Cc1ccc(C2=CC3(CCN(C(=S)NC4CCCCCCC4)CC3)ON2)cc1 |
| InChI | InChI=1S/C23H33N3OS/c1-18-9-11-19(12-10-18)21-17-23(27-25-21)13-15-26(16-14-23)22(28)24-20-7-5-3-2-4-6-8-20/h9-12,17,20,25H,2-8,13-16H2,1H3,(H,24,28) |
| InChIKey | QQWIXYFQBFGZBQ-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.60 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|