C22H31N3OS — CID 90811680
N-cyclooctyl-3-phenyl-1-oxa-2,8-diazaspiro[4.5]dec-3-ene-8-carbothioamide (PubChem CID 90811680) has the molecular formula C22H31N3OS and a molecular weight of 385.58 g/mol. Its IUPAC name is N-cyclooctyl-3-phenyl-1-oxa-2,8-diazaspiro[4.5]dec-3-ene-8-carbothioamide.
| Compound Name | N-cyclooctyl-3-phenyl-1-oxa-2,8-diazaspiro[4.5]dec-3-ene-8-carbothioamide |
|---|---|
| PubChem CID | 90811680 |
| Molecular Formula | C22H31N3OS |
| Molecular Weight | 385.58 g/mol |
| Exact Mass | 385.22 |
| IUPAC Name | N-cyclooctyl-3-phenyl-1-oxa-2,8-diazaspiro[4.5]dec-3-ene-8-carbothioamide |
| SMILES | S=C(NC1CCCCCCC1)N1CCC2(C=C(c3ccccc3)NO2)CC1 |
| InChI | InChI=1S/C22H31N3OS/c27-21(23-19-11-7-2-1-3-8-12-19)25-15-13-22(14-16-25)17-20(24-26-22)18-9-5-4-6-10-18/h4-6,9-10,17,19,24H,1-3,7-8,11-16H2,(H,23,27) |
| InChIKey | QZRPHSXQZFQQJI-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.58 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|