C24H35N3OS — CID 91261561
3-(4-tert-butylphenyl)-N-cyclohexyl-1-oxa-2,8-diazaspiro[4.5]dec-3-ene-8-carbothioamide (PubChem CID 91261561) has the molecular formula C24H35N3OS and a molecular weight of 413.63 g/mol. Its IUPAC name is 3-(4-tert-butylphenyl)-N-cyclohexyl-1-oxa-2,8-diazaspiro[4.5]dec-3-ene-8-carbothioamide.
| Compound Name | 3-(4-tert-butylphenyl)-N-cyclohexyl-1-oxa-2,8-diazaspiro[4.5]dec-3-ene-8-carbothioamide |
|---|---|
| PubChem CID | 91261561 |
| Molecular Formula | C24H35N3OS |
| Molecular Weight | 413.63 g/mol |
| Exact Mass | 413.25 |
| IUPAC Name | 3-(4-tert-butylphenyl)-N-cyclohexyl-1-oxa-2,8-diazaspiro[4.5]dec-3-ene-8-carbothioamide |
| SMILES | CC(C)(C)c1ccc(C2=CC3(CCN(C(=S)NC4CCCCC4)CC3)ON2)cc1 |
| InChI | InChI=1S/C24H35N3OS/c1-23(2,3)19-11-9-18(10-12-19)21-17-24(28-26-21)13-15-27(16-14-24)22(29)25-20-7-5-4-6-8-20/h9-12,17,20,26H,4-8,13-16H2,1-3H3,(H,25,29) |
| InChIKey | DWUIYMIBTPETSI-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.63 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|