C21H29N3OS — CID 91330069
N-cyclohexyl-3-(4-methylphenyl)-1-oxa-2,8-diazaspiro[4.5]dec-3-ene-8-carbothioamide (PubChem CID 91330069) has the molecular formula C21H29N3OS and a molecular weight of 371.55 g/mol. Its IUPAC name is N-cyclohexyl-3-(4-methylphenyl)-1-oxa-2,8-diazaspiro[4.5]dec-3-ene-8-carbothioamide.
| Compound Name | N-cyclohexyl-3-(4-methylphenyl)-1-oxa-2,8-diazaspiro[4.5]dec-3-ene-8-carbothioamide |
|---|---|
| PubChem CID | 91330069 |
| Molecular Formula | C21H29N3OS |
| Molecular Weight | 371.55 g/mol |
| Exact Mass | 371.20 |
| IUPAC Name | N-cyclohexyl-3-(4-methylphenyl)-1-oxa-2,8-diazaspiro[4.5]dec-3-ene-8-carbothioamide |
| SMILES | Cc1ccc(C2=CC3(CCN(C(=S)NC4CCCCC4)CC3)ON2)cc1 |
| InChI | InChI=1S/C21H29N3OS/c1-16-7-9-17(10-8-16)19-15-21(25-23-19)11-13-24(14-12-21)20(26)22-18-5-3-2-4-6-18/h7-10,15,18,23H,2-6,11-14H2,1H3,(H,22,26) |
| InChIKey | NWNYWWIKIJLZFI-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.55 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|