C25H37N3OS — CID 91165646
3-(4-tert-butylphenyl)-N-(cyclohexylmethyl)-1-oxa-2,8-diazaspiro[4.5]dec-3-ene-8-carbothioamide (PubChem CID 91165646) has the molecular formula C25H37N3OS and a molecular weight of 427.66 g/mol. Its IUPAC name is 3-(4-tert-butylphenyl)-N-(cyclohexylmethyl)-1-oxa-2,8-diazaspiro[4.5]dec-3-ene-8-carbothioamide.
| Compound Name | 3-(4-tert-butylphenyl)-N-(cyclohexylmethyl)-1-oxa-2,8-diazaspiro[4.5]dec-3-ene-8-carbothioamide |
|---|---|
| PubChem CID | 91165646 |
| Molecular Formula | C25H37N3OS |
| Molecular Weight | 427.66 g/mol |
| Exact Mass | 427.27 |
| IUPAC Name | 3-(4-tert-butylphenyl)-N-(cyclohexylmethyl)-1-oxa-2,8-diazaspiro[4.5]dec-3-ene-8-carbothioamide |
| SMILES | CC(C)(C)c1ccc(C2=CC3(CCN(C(=S)NCC4CCCCC4)CC3)ON2)cc1 |
| InChI | InChI=1S/C25H37N3OS/c1-24(2,3)21-11-9-20(10-12-21)22-17-25(29-27-22)13-15-28(16-14-25)23(30)26-18-19-7-5-4-6-8-19/h9-12,17,19,27H,4-8,13-16,18H2,1-3H3,(H,26,30) |
| InChIKey | KXYRBBNGHUVUBC-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.66 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|