C18H26N4OS — CID 57203002
N-[[3-(2,4,6-trimethylphenyl)-2,5-dihydro-1,2-oxazol-5-yl]methyl]piperazine-1-carbothioamide (PubChem CID 57203002) has the molecular formula C18H26N4OS and a molecular weight of 346.50 g/mol. Its IUPAC name is N-[[3-(2,4,6-trimethylphenyl)-2,5-dihydro-1,2-oxazol-5-yl]methyl]piperazine-1-carbothioamide.
| Compound Name | N-[[3-(2,4,6-trimethylphenyl)-2,5-dihydro-1,2-oxazol-5-yl]methyl]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 57203002 |
| Molecular Formula | C18H26N4OS |
| Molecular Weight | 346.50 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | N-[[3-(2,4,6-trimethylphenyl)-2,5-dihydro-1,2-oxazol-5-yl]methyl]piperazine-1-carbothioamide |
| SMILES | Cc1cc(C)c(C2=CC(CNC(=S)N3CCNCC3)ON2)c(C)c1 |
| InChI | InChI=1S/C18H26N4OS/c1-12-8-13(2)17(14(3)9-12)16-10-15(23-21-16)11-20-18(24)22-6-4-19-5-7-22/h8-10,15,19,21H,4-7,11H2,1-3H3,(H,20,24) |
| InChIKey | BBJMFMNPMACRCB-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 48.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.50 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|