C16H18F3N3O2S — CID 57285692
N-[[3-[3-(trifluoromethyl)phenyl]-2,5-dihydro-1,2-oxazol-5-yl]methyl]morpholine-4-carbothioamide (PubChem CID 57285692) has the molecular formula C16H18F3N3O2S and a molecular weight of 373.40 g/mol. Its IUPAC name is N-[[3-[3-(trifluoromethyl)phenyl]-2,5-dihydro-1,2-oxazol-5-yl]methyl]morpholine-4-carbothioamide.
| Compound Name | N-[[3-[3-(trifluoromethyl)phenyl]-2,5-dihydro-1,2-oxazol-5-yl]methyl]morpholine-4-carbothioamide |
|---|---|
| PubChem CID | 57285692 |
| Molecular Formula | C16H18F3N3O2S |
| Molecular Weight | 373.40 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | N-[[3-[3-(trifluoromethyl)phenyl]-2,5-dihydro-1,2-oxazol-5-yl]methyl]morpholine-4-carbothioamide |
| SMILES | FC(F)(F)c1cccc(C2=CC(CNC(=S)N3CCOCC3)ON2)c1 |
| InChI | InChI=1S/C16H18F3N3O2S/c17-16(18,19)12-3-1-2-11(8-12)14-9-13(24-21-14)10-20-15(25)22-4-6-23-7-5-22/h1-3,8-9,13,21H,4-7,10H2,(H,20,25) |
| InChIKey | WNSURGQNDZMYDQ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 45.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.40 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|