C12H15ClO2 — CID 57142479
[(2R,3S,4R)-2-(4-chlorophenyl)-3,4-dimethyloxetan-2-yl]methanol (PubChem CID 57142479) has the molecular formula C12H15ClO2 and a molecular weight of 226.70 g/mol. Its IUPAC name is [(2R,3S,4R)-2-(4-chlorophenyl)-3,4-dimethyloxetan-2-yl]methanol.
| Compound Name | [(2R,3S,4R)-2-(4-chlorophenyl)-3,4-dimethyloxetan-2-yl]methanol |
|---|---|
| PubChem CID | 57142479 |
| Molecular Formula | C12H15ClO2 |
| Molecular Weight | 226.70 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | [(2R,3S,4R)-2-(4-chlorophenyl)-3,4-dimethyloxetan-2-yl]methanol |
| SMILES | C[C@H]1O[C@@](CO)(c2ccc(Cl)cc2)[C@H]1C |
| InChI | InChI=1S/C12H15ClO2/c1-8-9(2)15-12(8,7-14)10-3-5-11(13)6-4-10/h3-6,8-9,14H,7H2,1-2H3/t8-,9+,12+/m0/s1 |
| InChIKey | DIMZCKGAJMRIOJ-YGOYTEALSA-N |
| XLogP | 2.58 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.70 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |