C11H22O2 — CID 57144082
3,5-dimethyl-2-(2-methylbutyl)-1,4-dioxane (PubChem CID 57144082) has the molecular formula C11H22O2 and a molecular weight of 186.29 g/mol. Its IUPAC name is 3,5-dimethyl-2-(2-methylbutyl)-1,4-dioxane.
| Compound Name | 3,5-dimethyl-2-(2-methylbutyl)-1,4-dioxane |
|---|---|
| PubChem CID | 57144082 |
| Molecular Formula | C11H22O2 |
| Molecular Weight | 186.29 g/mol |
| Exact Mass | 186.16 |
| IUPAC Name | 3,5-dimethyl-2-(2-methylbutyl)-1,4-dioxane |
| SMILES | CCC(C)CC1OCC(C)OC1C |
| InChI | InChI=1S/C11H22O2/c1-5-8(2)6-11-10(4)13-9(3)7-12-11/h8-11H,5-7H2,1-4H3 |
| InChIKey | BNSHHISRRNXCBP-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.29 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |