C27H30N2O5 — CID 57144604
1-O-[(2S)-4-amino-1-naphthalen-2-yl-4-oxobutan-2-yl] 3-O-[(2-aminophenyl)methyl] (2S)-2-propylpropanedioate (PubChem CID 57144604) has the molecular formula C27H30N2O5 and a molecular weight of 462.55 g/mol. Its IUPAC name is 1-O-[(2S)-4-amino-1-naphthalen-2-yl-4-oxobutan-2-yl] 3-O-[(2-aminophenyl)methyl] (2S)-2-propylpropanedioate.
| Compound Name | 1-O-[(2S)-4-amino-1-naphthalen-2-yl-4-oxobutan-2-yl] 3-O-[(2-aminophenyl)methyl] (2S)-2-propylpropanedioate |
|---|---|
| PubChem CID | 57144604 |
| Molecular Formula | C27H30N2O5 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.22 |
| IUPAC Name | 1-O-[(2S)-4-amino-1-naphthalen-2-yl-4-oxobutan-2-yl] 3-O-[(2-aminophenyl)methyl] (2S)-2-propylpropanedioate |
| SMILES | CCC[C@@H](C(=O)OCc1ccccc1N)C(=O)O[C@H](CC(N)=O)Cc1ccc2ccccc2c1 |
| InChI | InChI=1S/C27H30N2O5/c1-2-7-23(26(31)33-17-21-10-5-6-11-24(21)28)27(32)34-22(16-25(29)30)15-18-12-13-19-8-3-4-9-20(19)14-18/h3-6,8-14,22-23H,2,7,15-17,28H2,1H3,(H2,29,30)/t22-,23-/m0/s1 |
| InChIKey | RETJPKWLPJFIJR-GOTSBHOMSA-N |
| XLogP | 3.91 |
| TPSA | 121.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|