C18H27NO2S — CID 57145439
N-[3-(3,4-dihydro-2H-chromen-8-ylsulfanyloxy)propyl]cyclohexanamine (PubChem CID 57145439) has the molecular formula C18H27NO2S and a molecular weight of 321.49 g/mol. Its IUPAC name is N-[3-(3,4-dihydro-2H-chromen-8-ylsulfanyloxy)propyl]cyclohexanamine.
| Compound Name | N-[3-(3,4-dihydro-2H-chromen-8-ylsulfanyloxy)propyl]cyclohexanamine |
|---|---|
| PubChem CID | 57145439 |
| Molecular Formula | C18H27NO2S |
| Molecular Weight | 321.49 g/mol |
| Exact Mass | 321.18 |
| IUPAC Name | N-[3-(3,4-dihydro-2H-chromen-8-ylsulfanyloxy)propyl]cyclohexanamine |
| SMILES | c1cc2c(c(SOCCCNC3CCCCC3)c1)OCCC2 |
| InChI | InChI=1S/C18H27NO2S/c1-2-9-16(10-3-1)19-12-6-14-21-22-17-11-4-7-15-8-5-13-20-18(15)17/h4,7,11,16,19H,1-3,5-6,8-10,12-14H2 |
| InChIKey | OQIGCCRHYSNDHB-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.49 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|