C32H43N5O9S2 — CID 57147020
tert-butyl 3-[[5-[3-[[amino-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]methylidene]amino]prop-1-ynyl]thiophene-2-carbonyl]amino]-2-(benzenesulfonamido)propanoate (PubChem CID 57147020) has the molecular formula C32H43N5O9S2 and a molecular weight of 705.86 g/mol. Its IUPAC name is tert-butyl 3-[[5-[3-[[amino-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]methylidene]amino]prop-1-ynyl]thiophene-2-carbonyl]amino]-2-(benzenesulfonamido)propanoate.
| Compound Name | tert-butyl 3-[[5-[3-[[amino-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]methylidene]amino]prop-1-ynyl]thiophene-2-carbonyl]amino]-2-(benzenesulfonamido)propanoate |
|---|---|
| PubChem CID | 57147020 |
| Molecular Formula | C32H43N5O9S2 |
| Molecular Weight | 705.86 g/mol |
| Exact Mass | 705.25 |
| IUPAC Name | tert-butyl 3-[[5-[3-[[amino-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]methylidene]amino]prop-1-ynyl]thiophene-2-carbonyl]amino]-2-(benzenesulfonamido)propanoate |
| SMILES | CC(C)(C)OC(=O)C(CNC(=O)c1ccc(C#CC/N=C(\N)N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C)s1)NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C32H43N5O9S2/c1-30(2,3)44-26(39)23(36-48(42,43)22-15-11-10-12-16-22)20-35-25(38)24-18-17-21(47-24)14-13-19-34-27(33)37(28(40)45-31(4,5)6)29(41)46-32(7,8)9/h10-12,15-18,23,36H,19-20H2,1-9H3,(H2,33,34)(H,35,38) |
| InChIKey | VMPWZJOZJYQWDN-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 195.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.86 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|