C21H29N3O5S3 — CID 57147343
carbamoyl 2-[5-[[4-(dibutylamino)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]ethanesulfonate (PubChem CID 57147343) has the molecular formula C21H29N3O5S3 and a molecular weight of 499.68 g/mol. Its IUPAC name is carbamoyl 2-[5-[[4-(dibutylamino)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]ethanesulfonate.
| Compound Name | carbamoyl 2-[5-[[4-(dibutylamino)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]ethanesulfonate |
|---|---|
| PubChem CID | 57147343 |
| Molecular Formula | C21H29N3O5S3 |
| Molecular Weight | 499.68 g/mol |
| Exact Mass | 499.13 |
| IUPAC Name | carbamoyl 2-[5-[[4-(dibutylamino)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]ethanesulfonate |
| SMILES | CCCCN(CCCC)c1ccc(C=C2SC(=S)N(CCS(=O)(=O)OC(N)=O)C2=O)cc1 |
| InChI | InChI=1S/C21H29N3O5S3/c1-3-5-11-23(12-6-4-2)17-9-7-16(8-10-17)15-18-19(25)24(21(30)31-18)13-14-32(27,28)29-20(22)26/h7-10,15H,3-6,11-14H2,1-2H3,(H2,22,26) |
| InChIKey | CHSQOQRXLSQXPO-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 110.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.68 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|