C26H30FN3O4S3 — CID 54017856
2-[5-[[4-(dibutylamino)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(4-fluorophenyl)sulfonylacetamide (PubChem CID 54017856) has the molecular formula C26H30FN3O4S3 and a molecular weight of 563.74 g/mol. Its IUPAC name is 2-[5-[[4-(dibutylamino)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(4-fluorophenyl)sulfonylacetamide.
| Compound Name | 2-[5-[[4-(dibutylamino)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(4-fluorophenyl)sulfonylacetamide |
|---|---|
| PubChem CID | 54017856 |
| Molecular Formula | C26H30FN3O4S3 |
| Molecular Weight | 563.74 g/mol |
| Exact Mass | 563.14 |
| IUPAC Name | 2-[5-[[4-(dibutylamino)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(4-fluorophenyl)sulfonylacetamide |
| SMILES | CCCCN(CCCC)c1ccc(C=C2SC(=S)N(CC(=O)NS(=O)(=O)c3ccc(F)cc3)C2=O)cc1 |
| InChI | InChI=1S/C26H30FN3O4S3/c1-3-5-15-29(16-6-4-2)21-11-7-19(8-12-21)17-23-25(32)30(26(35)36-23)18-24(31)28-37(33,34)22-13-9-20(27)10-14-22/h7-14,17H,3-6,15-16,18H2,1-2H3,(H,28,31) |
| InChIKey | KWVPFQVMCYQXEO-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.74 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|