C8H8N2O3 — CID 57148663
4-(1,2-dinitrosoethyl)phenol (PubChem CID 57148663) has the molecular formula C8H8N2O3 and a molecular weight of 180.16 g/mol. Its IUPAC name is 4-(1,2-dinitrosoethyl)phenol.
| Compound Name | 4-(1,2-dinitrosoethyl)phenol |
|---|---|
| PubChem CID | 57148663 |
| Molecular Formula | C8H8N2O3 |
| Molecular Weight | 180.16 g/mol |
| Exact Mass | 180.05 |
| IUPAC Name | 4-(1,2-dinitrosoethyl)phenol |
| SMILES | O=NCC(N=O)c1ccc(O)cc1 |
| InChI | InChI=1S/C8H8N2O3/c11-7-3-1-6(2-4-7)8(10-13)5-9-12/h1-4,8,11H,5H2 |
| InChIKey | XDFVBGDVNNXBOH-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 79.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.16 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |