C22H29ClO4 — CID 57148743
2-[(8S,9S,10R,13S,14S,17R)-1-chloro-11-hydroxy-10,13-dimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]propanoic acid (PubChem CID 57148743) has the molecular formula C22H29ClO4 and a molecular weight of 392.92 g/mol. Its IUPAC name is 2-[(8S,9S,10R,13S,14S,17R)-1-chloro-11-hydroxy-10,13-dimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]propanoic acid.
| Compound Name | 2-[(8S,9S,10R,13S,14S,17R)-1-chloro-11-hydroxy-10,13-dimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]propanoic acid |
|---|---|
| PubChem CID | 57148743 |
| Molecular Formula | C22H29ClO4 |
| Molecular Weight | 392.92 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | 2-[(8S,9S,10R,13S,14S,17R)-1-chloro-11-hydroxy-10,13-dimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]propanoic acid |
| SMILES | CC(C(=O)O)[C@H]1CC[C@H]2[C@@H]3CCC4=CC(=O)C=C(Cl)[C@]4(C)[C@H]3C(O)C[C@]12C |
| InChI | InChI=1S/C22H29ClO4/c1-11(20(26)27)15-6-7-16-14-5-4-12-8-13(24)9-18(23)22(12,3)19(14)17(25)10-21(15,16)2/h8-9,11,14-17,19,25H,4-7,10H2,1-3H3,(H,26,27)/t11?,14-,15+,16-,17?,19+,21+,22+/m0/s1 |
| InChIKey | PPHNPOGZMIHNET-ARCPALDLSA-N |
| XLogP | 4.17 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.92 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |