C13H8Cl2O8S2-2 — CID 57153135
[5-chloro-3-[(5-chloro-2-hydroxy-3-sulfinatooxyphenyl)methyl]-2-hydroxyphenyl] sulfite (PubChem CID 57153135) has the molecular formula C13H8Cl2O8S2-2 and a molecular weight of 427.24 g/mol. Its IUPAC name is [5-chloro-3-[(5-chloro-2-hydroxy-3-sulfinatooxyphenyl)methyl]-2-hydroxyphenyl] sulfite.
| Compound Name | [5-chloro-3-[(5-chloro-2-hydroxy-3-sulfinatooxyphenyl)methyl]-2-hydroxyphenyl] sulfite |
|---|---|
| PubChem CID | 57153135 |
| Molecular Formula | C13H8Cl2O8S2-2 |
| Molecular Weight | 427.24 g/mol |
| Exact Mass | 425.90 |
| IUPAC Name | [5-chloro-3-[(5-chloro-2-hydroxy-3-sulfinatooxyphenyl)methyl]-2-hydroxyphenyl] sulfite |
| SMILES | O=S([O-])Oc1cc(Cl)cc(Cc2cc(Cl)cc(OS(=O)[O-])c2O)c1O |
| InChI | InChI=1S/C13H10Cl2O8S2/c14-8-2-6(12(16)10(4-8)22-24(18)19)1-7-3-9(15)5-11(13(7)17)23-25(20)21/h2-5,16-17H,1H2,(H,18,19)(H,20,21)/p-2 |
| InChIKey | NIJRZLHQRDSTMM-UHFFFAOYSA-L |
| XLogP | 2.34 |
| TPSA | 139.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.24 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|