C20H13Br2Cl2NO5 — CID 13064203
2,6-bis[(3-bromo-5-chloro-2-hydroxyphenyl)methyl]-4-nitrophenol (PubChem CID 13064203) has the molecular formula C20H13Br2Cl2NO5 and a molecular weight of 578.04 g/mol. Its IUPAC name is 2,6-bis[(3-bromo-5-chloro-2-hydroxyphenyl)methyl]-4-nitrophenol.
| Compound Name | 2,6-bis[(3-bromo-5-chloro-2-hydroxyphenyl)methyl]-4-nitrophenol |
|---|---|
| PubChem CID | 13064203 |
| Molecular Formula | C20H13Br2Cl2NO5 |
| Molecular Weight | 578.04 g/mol |
| Exact Mass | 574.85 |
| IUPAC Name | 2,6-bis[(3-bromo-5-chloro-2-hydroxyphenyl)methyl]-4-nitrophenol |
| SMILES | O=[N+]([O-])c1cc(Cc2cc(Cl)cc(Br)c2O)c(O)c(Cc2cc(Cl)cc(Br)c2O)c1 |
| InChI | InChI=1S/C20H13Br2Cl2NO5/c21-16-7-13(23)3-9(19(16)27)1-11-5-15(25(29)30)6-12(18(11)26)2-10-4-14(24)8-17(22)20(10)28/h3-8,26-28H,1-2H2 |
| InChIKey | HZEZGDMCYJRHEN-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 103.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.04 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|