C13H8BrIN2O6 — CID 12800505
2-[(5-bromo-2-hydroxy-3-iodophenyl)methyl]-4,6-dinitrophenol (PubChem CID 12800505) has the molecular formula C13H8BrIN2O6 and a molecular weight of 495.02 g/mol. Its IUPAC name is 2-[(5-bromo-2-hydroxy-3-iodophenyl)methyl]-4,6-dinitrophenol.
| Compound Name | 2-[(5-bromo-2-hydroxy-3-iodophenyl)methyl]-4,6-dinitrophenol |
|---|---|
| PubChem CID | 12800505 |
| Molecular Formula | C13H8BrIN2O6 |
| Molecular Weight | 495.02 g/mol |
| Exact Mass | 493.86 |
| IUPAC Name | 2-[(5-bromo-2-hydroxy-3-iodophenyl)methyl]-4,6-dinitrophenol |
| SMILES | O=[N+]([O-])c1cc(Cc2cc(Br)cc(I)c2O)c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H8BrIN2O6/c14-8-2-6(12(18)10(15)4-8)1-7-3-9(16(20)21)5-11(13(7)19)17(22)23/h2-5,18-19H,1H2 |
| InChIKey | LBZGPJJQBINRKH-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 126.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.02 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|